C17H26Cl2N6O3 — CID 91368685
3-[4-(3-aminopropoxy)-3,5-dichlorophenyl]-N-[4-(diaminomethylideneamino)butyl]-2-nitrosopropanamide (PubChem CID 91368685) has the molecular formula C17H26Cl2N6O3 and a molecular weight of 433.34 g/mol. Its IUPAC name is 3-[4-(3-aminopropoxy)-3,5-dichlorophenyl]-N-[4-(diaminomethylideneamino)butyl]-2-nitrosopropanamide.
| Compound Name | 3-[4-(3-aminopropoxy)-3,5-dichlorophenyl]-N-[4-(diaminomethylideneamino)butyl]-2-nitrosopropanamide |
|---|---|
| PubChem CID | 91368685 |
| Molecular Formula | C17H26Cl2N6O3 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3-[4-(3-aminopropoxy)-3,5-dichlorophenyl]-N-[4-(diaminomethylideneamino)butyl]-2-nitrosopropanamide |
| SMILES | NCCCOc1c(Cl)cc(CC(N=O)C(=O)NCCCCN=C(N)N)cc1Cl |
| InChI | InChI=1S/C17H26Cl2N6O3/c18-12-8-11(9-13(19)15(12)28-7-3-4-20)10-14(25-27)16(26)23-5-1-2-6-24-17(21)22/h8-9,14H,1-7,10,20H2,(H,23,26)(H4,21,22,24) |
| InChIKey | QFFONNLJEXTHID-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|