C21H25Br2N3O3 — CID 162856849
N-[2-[3,5-dibromo-4-[3-(methylamino)propoxy]phenyl]ethyl]-2-hydroxyimino-3-phenylpropanamide (PubChem CID 162856849) has the molecular formula C21H25Br2N3O3 and a molecular weight of 527.26 g/mol. Its IUPAC name is N-[2-[3,5-dibromo-4-[3-(methylamino)propoxy]phenyl]ethyl]-2-hydroxyimino-3-phenylpropanamide.
| Compound Name | N-[2-[3,5-dibromo-4-[3-(methylamino)propoxy]phenyl]ethyl]-2-hydroxyimino-3-phenylpropanamide |
|---|---|
| PubChem CID | 162856849 |
| Molecular Formula | C21H25Br2N3O3 |
| Molecular Weight | 527.26 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | N-[2-[3,5-dibromo-4-[3-(methylamino)propoxy]phenyl]ethyl]-2-hydroxyimino-3-phenylpropanamide |
| SMILES | CNCCCOc1c(Br)cc(CCNC(=O)C(Cc2ccccc2)=NO)cc1Br |
| InChI | InChI=1S/C21H25Br2N3O3/c1-24-9-5-11-29-20-17(22)12-16(13-18(20)23)8-10-25-21(27)19(26-28)14-15-6-3-2-4-7-15/h2-4,6-7,12-13,24,28H,5,8-11,14H2,1H3,(H,25,27) |
| InChIKey | VNDUXZIXUOPMIK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|