C24H28Br3N3O6 — CID 10985336
methyl N-[3-[2,6-dibromo-4-[2-[[(2E)-3-(3-bromo-4-methoxyphenyl)-2-hydroxyiminopropanoyl]amino]ethyl]phenoxy]propyl]-N-methylcarbamate (PubChem CID 10985336) has the molecular formula C24H28Br3N3O6 and a molecular weight of 694.22 g/mol. Its IUPAC name is methyl N-[3-[2,6-dibromo-4-[2-[[(2E)-3-(3-bromo-4-methoxyphenyl)-2-hydroxyiminopropanoyl]amino]ethyl]phenoxy]propyl]-N-methylcarbamate.
| Compound Name | methyl N-[3-[2,6-dibromo-4-[2-[[(2E)-3-(3-bromo-4-methoxyphenyl)-2-hydroxyiminopropanoyl]amino]ethyl]phenoxy]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 10985336 |
| Molecular Formula | C24H28Br3N3O6 |
| Molecular Weight | 694.22 g/mol |
| Exact Mass | 690.95 |
| IUPAC Name | methyl N-[3-[2,6-dibromo-4-[2-[[(2E)-3-(3-bromo-4-methoxyphenyl)-2-hydroxyiminopropanoyl]amino]ethyl]phenoxy]propyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)CCCOc1c(Br)cc(CCNC(=O)/C(Cc2ccc(OC)c(Br)c2)=N/O)cc1Br |
| InChI | InChI=1S/C24H28Br3N3O6/c1-30(24(32)35-3)9-4-10-36-22-18(26)12-16(13-19(22)27)7-8-28-23(31)20(29-33)14-15-5-6-21(34-2)17(25)11-15/h5-6,11-13,33H,4,7-10,14H2,1-3H3,(H,28,31)/b29-20+ |
| InChIKey | MEVGLLZJEYGKGP-ZTKZIYFRSA-N |
| XLogP | 5.18 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.22 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|