C21H26Br2ClN3O4 — CID 11592301
(2E)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-2-hydroxyimino-N-[2-(4-methoxyphenyl)ethyl]propanamide;hydrochloride (PubChem CID 11592301) has the molecular formula C21H26Br2ClN3O4 and a molecular weight of 579.72 g/mol. Its IUPAC name is (2E)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-2-hydroxyimino-N-[2-(4-methoxyphenyl)ethyl]propanamide;hydrochloride.
| Compound Name | (2E)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-2-hydroxyimino-N-[2-(4-methoxyphenyl)ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 11592301 |
| Molecular Formula | C21H26Br2ClN3O4 |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 577.00 |
| IUPAC Name | (2E)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-2-hydroxyimino-N-[2-(4-methoxyphenyl)ethyl]propanamide;hydrochloride |
| SMILES | COc1ccc(CCNC(=O)/C(Cc2cc(Br)c(OCCCN)c(Br)c2)=N/O)cc1.Cl |
| InChI | InChI=1S/C21H25Br2N3O4.ClH/c1-29-16-5-3-14(4-6-16)7-9-25-21(27)19(26-28)13-15-11-17(22)20(18(23)12-15)30-10-2-8-24;/h3-6,11-12,28H,2,7-10,13,24H2,1H3,(H,25,27);1H/b26-19+; |
| InChIKey | WBZVZSVFEDJPID-MGXPCBRFSA-N |
| XLogP | 4.10 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|