About (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide
(2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide (PubChem CID 56589774) has the molecular formula C14H19Br2N3O3
and a molecular weight of 437.13 g/mol. Its IUPAC name is (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide.
Molecular Properties
| Compound Name | (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide |
| PubChem CID | 56589774 |
| Molecular Formula | C14H19Br2N3O3 |
| Molecular Weight | 437.13 g/mol |
| Exact Mass | 434.98 |
| IUPAC Name | (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide |
| SMILES | CNCCCNC(=O)/C(Cc1cc(Br)c(OC)c(Br)c1)=N/O |
| InChI | InChI=1S/C14H19Br2N3O3/c1-17-4-3-5-18-14(20)12(19-21)8-9-6-10(15)13(22-2)11(16)7-9/h6-7,17,21H,3-5,8H2,1-2H3,(H,18,20)/b19-12+ |
| InChIKey | WSJXNKLYMMJIOZ-XDHOZWIPSA-N |
| XLogP | 2.32 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.13 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide?
The IUPAC name of (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide (CID 56589774) is (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide.
What is the SMILES notation for (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide?
The canonical SMILES for (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide is CNCCCNC(=O)/C(Cc1cc(Br)c(OC)c(Br)c1)=N/O.
What is the InChIKey of (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide?
The InChIKey is WSJXNKLYMMJIOZ-XDHOZWIPSA-N. The full InChI is InChI=1S/C14H19Br2N3O3/c1-17-4-3-5-18-14(20)12(19-21)8-9-6-10(15)13(22-2)11(16)7-9/h6-7,17,21H,3-5,8H2,1-2H3,(H,18,20)/b19-12+.
What are the key properties of (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide?
(2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide has a molecular weight of 437.13 g/mol, XLogP of 2.32, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxyimino-N-[3-(methylamino)propyl]propanamide is sourced from PubChem (CID 56589774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).