C18H29Br2ClN4O3 — CID 10076080
(2E)-N-(6-aminohexyl)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-2-hydroxyiminopropanamide;hydrochloride (PubChem CID 10076080) has the molecular formula C18H29Br2ClN4O3 and a molecular weight of 544.72 g/mol. Its IUPAC name is (2E)-N-(6-aminohexyl)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-2-hydroxyiminopropanamide;hydrochloride.
| Compound Name | (2E)-N-(6-aminohexyl)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-2-hydroxyiminopropanamide;hydrochloride |
|---|---|
| PubChem CID | 10076080 |
| Molecular Formula | C18H29Br2ClN4O3 |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | (2E)-N-(6-aminohexyl)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-2-hydroxyiminopropanamide;hydrochloride |
| SMILES | Cl.NCCCCCCNC(=O)/C(Cc1cc(Br)c(OCCCN)c(Br)c1)=N/O |
| InChI | InChI=1S/C18H28Br2N4O3.ClH/c19-14-10-13(11-15(20)17(14)27-9-5-7-22)12-16(24-26)18(25)23-8-4-2-1-3-6-21;/h10-11,26H,1-9,12,21-22H2,(H,23,25);1H/b24-16+; |
| InChIKey | FUQDGIJRLKTSFS-RSOFWHLMSA-N |
| XLogP | 3.37 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|