C23H28Br3N3O5 — CID 172928324
(2E)-3-(3-bromo-4-methoxyphenyl)-N-[(2R)-2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]-2-hydroxyethyl]-2-hydroxyiminopropanamide (PubChem CID 172928324) has the molecular formula C23H28Br3N3O5 and a molecular weight of 666.21 g/mol. Its IUPAC name is (2E)-3-(3-bromo-4-methoxyphenyl)-N-[(2R)-2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]-2-hydroxyethyl]-2-hydroxyiminopropanamide.
| Compound Name | (2E)-3-(3-bromo-4-methoxyphenyl)-N-[(2R)-2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]-2-hydroxyethyl]-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 172928324 |
| Molecular Formula | C23H28Br3N3O5 |
| Molecular Weight | 666.21 g/mol |
| Exact Mass | 662.96 |
| IUPAC Name | (2E)-3-(3-bromo-4-methoxyphenyl)-N-[(2R)-2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]-2-hydroxyethyl]-2-hydroxyiminopropanamide |
| SMILES | COc1ccc(C/C(=N\O)C(=O)NC[C@H](O)c2cc(Br)c(OCCCN(C)C)c(Br)c2)cc1Br |
| InChI | InChI=1S/C23H28Br3N3O5/c1-29(2)7-4-8-34-22-17(25)11-15(12-18(22)26)20(30)13-27-23(31)19(28-32)10-14-5-6-21(33-3)16(24)9-14/h5-6,9,11-12,20,30,32H,4,7-8,10,13H2,1-3H3,(H,27,31)/b28-19+/t20-/m0/s1 |
| InChIKey | FZBQAWDXVQGOIC-GBZINIMXSA-N |
| XLogP | 4.54 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.21 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|