C18H16Br4N2O6 — CID 10078238
(2E)-3-(3,5-dibromo-2-hydroxy-4-methoxyphenyl)-N-[2-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxyethyl]-2-hydroxyiminopropanamide (PubChem CID 10078238) has the molecular formula C18H16Br4N2O6 and a molecular weight of 675.95 g/mol. Its IUPAC name is (2E)-3-(3,5-dibromo-2-hydroxy-4-methoxyphenyl)-N-[2-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxyethyl]-2-hydroxyiminopropanamide.
| Compound Name | (2E)-3-(3,5-dibromo-2-hydroxy-4-methoxyphenyl)-N-[2-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxyethyl]-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 10078238 |
| Molecular Formula | C18H16Br4N2O6 |
| Molecular Weight | 675.95 g/mol |
| Exact Mass | 671.77 |
| IUPAC Name | (2E)-3-(3,5-dibromo-2-hydroxy-4-methoxyphenyl)-N-[2-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxyethyl]-2-hydroxyiminopropanamide |
| SMILES | COc1c(Br)cc(C/C(=N\O)C(=O)NCC(O)c2cc(Br)c(O)c(Br)c2)c(O)c1Br |
| InChI | InChI=1S/C18H16Br4N2O6/c1-30-17-11(21)4-8(15(26)14(17)22)5-12(24-29)18(28)23-6-13(25)7-2-9(19)16(27)10(20)3-7/h2-4,13,25-27,29H,5-6H2,1H3,(H,23,28)/b24-12+ |
| InChIKey | JSISCGQPWRFUCM-WYMPLXKRSA-N |
| XLogP | 4.38 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.95 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|