C18H17Br2NO5 — CID 11612814
methyl (2E)-3-(3,5-dibromo-4-methoxy-2-phenylmethoxyphenyl)-2-hydroxyiminopropanoate (PubChem CID 11612814) has the molecular formula C18H17Br2NO5 and a molecular weight of 487.14 g/mol. Its IUPAC name is methyl (2E)-3-(3,5-dibromo-4-methoxy-2-phenylmethoxyphenyl)-2-hydroxyiminopropanoate.
| Compound Name | methyl (2E)-3-(3,5-dibromo-4-methoxy-2-phenylmethoxyphenyl)-2-hydroxyiminopropanoate |
|---|---|
| PubChem CID | 11612814 |
| Molecular Formula | C18H17Br2NO5 |
| Molecular Weight | 487.14 g/mol |
| Exact Mass | 484.95 |
| IUPAC Name | methyl (2E)-3-(3,5-dibromo-4-methoxy-2-phenylmethoxyphenyl)-2-hydroxyiminopropanoate |
| SMILES | COC(=O)/C(Cc1cc(Br)c(OC)c(Br)c1OCc1ccccc1)=N/O |
| InChI | InChI=1S/C18H17Br2NO5/c1-24-17-13(19)8-12(9-14(21-23)18(22)25-2)16(15(17)20)26-10-11-6-4-3-5-7-11/h3-8,23H,9-10H2,1-2H3/b21-14+ |
| InChIKey | MPUIGYOMEOOHNO-KGENOOAVSA-N |
| XLogP | 4.34 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.14 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|