C30H34Br3N3O5 — CID 71665190
(2E)-3-(3-bromo-4-methoxyphenyl)-N-[(2S)-2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]-2-hydroxyethyl]-2-phenylmethoxyiminopropanamide (PubChem CID 71665190) has the molecular formula C30H34Br3N3O5 and a molecular weight of 756.33 g/mol. Its IUPAC name is (2E)-3-(3-bromo-4-methoxyphenyl)-N-[(2S)-2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]-2-hydroxyethyl]-2-phenylmethoxyiminopropanamide.
| Compound Name | (2E)-3-(3-bromo-4-methoxyphenyl)-N-[(2S)-2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]-2-hydroxyethyl]-2-phenylmethoxyiminopropanamide |
|---|---|
| PubChem CID | 71665190 |
| Molecular Formula | C30H34Br3N3O5 |
| Molecular Weight | 756.33 g/mol |
| Exact Mass | 753.00 |
| IUPAC Name | (2E)-3-(3-bromo-4-methoxyphenyl)-N-[(2S)-2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]-2-hydroxyethyl]-2-phenylmethoxyiminopropanamide |
| SMILES | COc1ccc(C/C(=N\OCc2ccccc2)C(=O)NC[C@@H](O)c2cc(Br)c(OCCCN(C)C)c(Br)c2)cc1Br |
| InChI | InChI=1S/C30H34Br3N3O5/c1-36(2)12-7-13-40-29-24(32)16-22(17-25(29)33)27(37)18-34-30(38)26(35-41-19-20-8-5-4-6-9-20)15-21-10-11-28(39-3)23(31)14-21/h4-6,8-11,14,16-17,27,37H,7,12-13,15,18-19H2,1-3H3,(H,34,38)/b35-26+/t27-/m1/s1 |
| InChIKey | CXJKHXHDQQHCAI-BWWJESOWSA-N |
| XLogP | 6.28 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.33 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|