C12H18BrNO — CID 170865219
3-(3-bromo-4-methoxyphenyl)-N,N-dimethylpropan-1-amine (PubChem CID 170865219) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170865219 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc(CCCN(C)C)cc1Br |
| InChI | InChI=1S/C12H18BrNO/c1-14(2)8-4-5-10-6-7-12(15-3)11(13)9-10/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | FCGJBIOZSBXOCW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |