C16H18BrNO2S2 — CID 8757204
N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 8757204) has the molecular formula C16H18BrNO2S2 and a molecular weight of 400.36 g/mol. Its IUPAC name is N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 8757204 |
| Molecular Formula | C16H18BrNO2S2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCSCc2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C16H18BrNO2S2/c1-20-13-4-2-12(3-5-13)10-16(19)18-8-9-21-11-14-6-7-15(17)22-14/h2-7H,8-11H2,1H3,(H,18,19) |
| InChIKey | ZUHZILYMFOAKIC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|