C15H16BrNO2S2 — CID 8757202
N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-3-methoxybenzamide (PubChem CID 8757202) has the molecular formula C15H16BrNO2S2 and a molecular weight of 386.34 g/mol. Its IUPAC name is N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-3-methoxybenzamide.
| Compound Name | N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 8757202 |
| Molecular Formula | C15H16BrNO2S2 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCSCc2ccc(Br)s2)c1 |
| InChI | InChI=1S/C15H16BrNO2S2/c1-19-12-4-2-3-11(9-12)15(18)17-7-8-20-10-13-5-6-14(16)21-13/h2-6,9H,7-8,10H2,1H3,(H,17,18) |
| InChIKey | YKHVIMYSVFHRJS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|