C18H24N4O2S — CID 111897267
3-methoxy-N-[2-[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111897267) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 3-methoxy-N-[2-[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 3-methoxy-N-[2-[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111897267 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-methoxy-N-[2-[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(/NCCNC(=O)c1cccc(OC)c1)NCc1ccc(C)s1 |
| InChI | InChI=1S/C18H24N4O2S/c1-13-7-8-16(25-13)12-22-18(19-2)21-10-9-20-17(23)14-5-4-6-15(11-14)24-3/h4-8,11H,9-10,12H2,1-3H3,(H,20,23)(H2,19,21,22) |
| InChIKey | FMLKAAIPOLIBII-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|