C23H33IN4O3 — CID 111690449
3-methoxy-N-[2-[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111690449) has the molecular formula C23H33IN4O3 and a molecular weight of 540.45 g/mol. Its IUPAC name is 3-methoxy-N-[2-[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 3-methoxy-N-[2-[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111690449 |
| Molecular Formula | C23H33IN4O3 |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 3-methoxy-N-[2-[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1cccc(OC)c1)NCc1ccccc1OC(C)(C)C.I |
| InChI | InChI=1S/C23H32N4O3.HI/c1-23(2,3)30-20-12-7-6-9-18(20)16-27-22(24-4)26-14-13-25-21(28)17-10-8-11-19(15-17)29-5;/h6-12,15H,13-14,16H2,1-5H3,(H,25,28)(H2,24,26,27);1H |
| InChIKey | BWJUNCPJEZWYFP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|