C16H17BrFNO2S2 — CID 18278621
N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-2-(3-fluoro-4-methoxyphenyl)acetamide (PubChem CID 18278621) has the molecular formula C16H17BrFNO2S2 and a molecular weight of 418.35 g/mol. Its IUPAC name is N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-2-(3-fluoro-4-methoxyphenyl)acetamide.
| Compound Name | N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-2-(3-fluoro-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18278621 |
| Molecular Formula | C16H17BrFNO2S2 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-2-(3-fluoro-4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCSCc2ccc(Br)s2)cc1F |
| InChI | InChI=1S/C16H17BrFNO2S2/c1-21-14-4-2-11(8-13(14)18)9-16(20)19-6-7-22-10-12-3-5-15(17)23-12/h2-5,8H,6-7,9-10H2,1H3,(H,19,20) |
| InChIKey | LTKKEXCNWJJEBZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|