C14H14BrNO2S3 — CID 30874958
5-acetyl-N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]thiophene-2-carboxamide (PubChem CID 30874958) has the molecular formula C14H14BrNO2S3 and a molecular weight of 404.38 g/mol. Its IUPAC name is 5-acetyl-N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 30874958 |
| Molecular Formula | C14H14BrNO2S3 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | 5-acetyl-N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)NCCSCc2ccc(Br)s2)s1 |
| InChI | InChI=1S/C14H14BrNO2S3/c1-9(17)11-3-4-12(21-11)14(18)16-6-7-19-8-10-2-5-13(15)20-10/h2-5H,6-8H2,1H3,(H,16,18) |
| InChIKey | FCMDNCVIICTMGG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|