C16H15BrN2O3S2 — CID 37408563
N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide (PubChem CID 37408563) has the molecular formula C16H15BrN2O3S2 and a molecular weight of 427.35 g/mol. Its IUPAC name is N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide.
| Compound Name | N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide |
|---|---|
| PubChem CID | 37408563 |
| Molecular Formula | C16H15BrN2O3S2 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide |
| SMILES | O=C1COc2cc(C(=O)NCCSCc3ccc(Br)s3)ccc2N1 |
| InChI | InChI=1S/C16H15BrN2O3S2/c17-14-4-2-11(24-14)9-23-6-5-18-16(21)10-1-3-12-13(7-10)22-8-15(20)19-12/h1-4,7H,5-6,8-9H2,(H,18,21)(H,19,20) |
| InChIKey | CYRZZSDYNZWONS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|