C18H17FN2O3S — CID 27708277
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide (PubChem CID 27708277) has the molecular formula C18H17FN2O3S and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide |
|---|---|
| PubChem CID | 27708277 |
| Molecular Formula | C18H17FN2O3S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide |
| SMILES | O=C1COc2cc(C(=O)NCCSCc3ccccc3F)ccc2N1 |
| InChI | InChI=1S/C18H17FN2O3S/c19-14-4-2-1-3-13(14)11-25-8-7-20-18(23)12-5-6-15-16(9-12)24-10-17(22)21-15/h1-6,9H,7-8,10-11H2,(H,20,23)(H,21,22) |
| InChIKey | GUVNLBWNCFFYMN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|