C15H15N5O3 — CID 51078811
3-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-4H-1,4-benzoxazine-7-carboxamide (PubChem CID 51078811) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is 3-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-4H-1,4-benzoxazine-7-carboxamide.
| Compound Name | 3-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-4H-1,4-benzoxazine-7-carboxamide |
|---|---|
| PubChem CID | 51078811 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-4H-1,4-benzoxazine-7-carboxamide |
| SMILES | O=C1COc2cc(C(=O)NCCNc3ncccn3)ccc2N1 |
| InChI | InChI=1S/C15H15N5O3/c21-13-9-23-12-8-10(2-3-11(12)20-13)14(22)16-6-7-19-15-17-4-1-5-18-15/h1-5,8H,6-7,9H2,(H,16,22)(H,20,21)(H,17,18,19) |
| InChIKey | ZSDHKAQLZRSLJE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|