C19H19FN2O4 — CID 32645005
N-[4-(4-fluorophenoxy)butyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide (PubChem CID 32645005) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)butyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide.
| Compound Name | N-[4-(4-fluorophenoxy)butyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide |
|---|---|
| PubChem CID | 32645005 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[4-(4-fluorophenoxy)butyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide |
| SMILES | O=C1COc2cc(C(=O)NCCCCOc3ccc(F)cc3)ccc2N1 |
| InChI | InChI=1S/C19H19FN2O4/c20-14-4-6-15(7-5-14)25-10-2-1-9-21-19(24)13-3-8-16-17(11-13)26-12-18(23)22-16/h3-8,11H,1-2,9-10,12H2,(H,21,24)(H,22,23) |
| InChIKey | TUJNSIWAHMNWJG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|