C16H15FN2O3S — CID 8743437
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-nitrobenzamide (PubChem CID 8743437) has the molecular formula C16H15FN2O3S and a molecular weight of 334.37 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 8743437 |
| Molecular Formula | C16H15FN2O3S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-nitrobenzamide |
| SMILES | O=C(NCCSCc1ccccc1F)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15FN2O3S/c17-15-7-2-1-4-13(15)11-23-9-8-18-16(20)12-5-3-6-14(10-12)19(21)22/h1-7,10H,8-9,11H2,(H,18,20) |
| InChIKey | DNIAFUVOTPAYQE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|