C17H18FN3O2S — CID 78806424
4-(carbamoylamino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 78806424) has the molecular formula C17H18FN3O2S and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-(carbamoylamino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 4-(carbamoylamino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 78806424 |
| Molecular Formula | C17H18FN3O2S |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4-(carbamoylamino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | NC(=O)Nc1ccc(C(=O)NCCSCc2ccccc2F)cc1 |
| InChI | InChI=1S/C17H18FN3O2S/c18-15-4-2-1-3-13(15)11-24-10-9-20-16(22)12-5-7-14(8-6-12)21-17(19)23/h1-8H,9-11H2,(H,20,22)(H3,19,21,23) |
| InChIKey | RDGSNBVVIBQVGB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|