C12H17BrN2O2S3 — CID 30874917
3-(2-amino-2-oxoethyl)sulfanyl-N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]propanamide (PubChem CID 30874917) has the molecular formula C12H17BrN2O2S3 and a molecular weight of 397.39 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]propanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 30874917 |
| Molecular Formula | C12H17BrN2O2S3 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 395.96 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-[2-[(5-bromothiophen-2-yl)methylsulfanyl]ethyl]propanamide |
| SMILES | NC(=O)CSCCC(=O)NCCSCc1ccc(Br)s1 |
| InChI | InChI=1S/C12H17BrN2O2S3/c13-10-2-1-9(20-10)7-19-6-4-15-12(17)3-5-18-8-11(14)16/h1-2H,3-8H2,(H2,14,16)(H,15,17) |
| InChIKey | YUFAMZZCZLNHRJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|