C8H13ClN2O2S — CID 115636966
3-(2-amino-2-oxoethyl)sulfanyl-N-(2-chloroprop-2-enyl)propanamide (PubChem CID 115636966) has the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-(2-chloroprop-2-enyl)propanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(2-chloroprop-2-enyl)propanamide |
|---|---|
| PubChem CID | 115636966 |
| Molecular Formula | C8H13ClN2O2S |
| Molecular Weight | 236.72 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(2-chloroprop-2-enyl)propanamide |
| SMILES | C=C(Cl)CNC(=O)CCSCC(N)=O |
| InChI | InChI=1S/C8H13ClN2O2S/c1-6(9)4-11-8(13)2-3-14-5-7(10)12/h1-5H2,(H2,10,12)(H,11,13) |
| InChIKey | FJOBMFLYCCGPDB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.72 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|