C13H24N2O4S — CID 107474513
2-[[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]methyl]-4,4-dimethylpentanoic acid (PubChem CID 107474513) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is 2-[[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]methyl]-4,4-dimethylpentanoic acid.
| Compound Name | 2-[[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]methyl]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 107474513 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]methyl]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(CNC(=O)CCSCC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H24N2O4S/c1-13(2,3)6-9(12(18)19)7-15-11(17)4-5-20-8-10(14)16/h9H,4-8H2,1-3H3,(H2,14,16)(H,15,17)(H,18,19) |
| InChIKey | XRHDSSXEPKEVFE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|