C5H10N2O3S — CID 22287106
3-(2-amino-2-oxoethyl)sulfanyl-N-hydroxypropanamide (PubChem CID 22287106) has the molecular formula C5H10N2O3S and a molecular weight of 178.21 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-hydroxypropanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-hydroxypropanamide |
|---|---|
| PubChem CID | 22287106 |
| Molecular Formula | C5H10N2O3S |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-hydroxypropanamide |
| SMILES | NC(=O)CSCCC(=O)NO |
| InChI | InChI=1S/C5H10N2O3S/c6-4(8)3-11-2-1-5(9)7-10/h10H,1-3H2,(H2,6,8)(H,7,9) |
| InChIKey | HWWCOCCRJURMBN-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|