About N'-hydroxybutanediamide;hydrofluoride
N'-hydroxybutanediamide;hydrofluoride (PubChem CID 174508828) has the molecular formula C4H9FN2O3
and a molecular weight of 152.12 g/mol. Its IUPAC name is N'-hydroxybutanediamide;hydrofluoride.
Molecular Properties
| Compound Name | N'-hydroxybutanediamide;hydrofluoride |
| PubChem CID | 174508828 |
| Molecular Formula | C4H9FN2O3 |
| Molecular Weight | 152.12 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | N'-hydroxybutanediamide;hydrofluoride |
| SMILES | F.NC(=O)CCC(=O)NO |
| InChI | InChI=1S/C4H8N2O3.FH/c5-3(7)1-2-4(8)6-9;/h9H,1-2H2,(H2,5,7)(H,6,8);1H |
| InChIKey | LDDLMAXIDCTAGE-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.12 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxybutanediamide;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxybutanediamide;hydrofluoride?
The IUPAC name of N'-hydroxybutanediamide;hydrofluoride (CID 174508828) is N'-hydroxybutanediamide;hydrofluoride.
What is the SMILES notation for N'-hydroxybutanediamide;hydrofluoride?
The canonical SMILES for N'-hydroxybutanediamide;hydrofluoride is F.NC(=O)CCC(=O)NO.
What is the InChIKey of N'-hydroxybutanediamide;hydrofluoride?
The InChIKey is LDDLMAXIDCTAGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O3.FH/c5-3(7)1-2-4(8)6-9;/h9H,1-2H2,(H2,5,7)(H,6,8);1H.
What are the key properties of N'-hydroxybutanediamide;hydrofluoride?
N'-hydroxybutanediamide;hydrofluoride has a molecular weight of 152.12 g/mol, XLogP of -1.09, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxybutanediamide;hydrofluoride is sourced from PubChem (CID 174508828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).