About ethane;N'-hydroxyoctanediamide
ethane;N'-hydroxyoctanediamide (PubChem CID 144754010) has the molecular formula C10H22N2O3
and a molecular weight of 218.30 g/mol. Its IUPAC name is ethane;N'-hydroxyoctanediamide.
Molecular Properties
| Compound Name | ethane;N'-hydroxyoctanediamide |
| PubChem CID | 144754010 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | ethane;N'-hydroxyoctanediamide |
| SMILES | CC.NC(=O)CCCCCCC(=O)NO |
| InChI | InChI=1S/C8H16N2O3.C2H6/c9-7(11)5-3-1-2-4-6-8(12)10-13;1-2/h13H,1-6H2,(H2,9,11)(H,10,12);1-2H3 |
| InChIKey | QYHHLUIMNHDJJG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-hydroxyoctanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-hydroxyoctanediamide?
The IUPAC name of ethane;N'-hydroxyoctanediamide (CID 144754010) is ethane;N'-hydroxyoctanediamide.
What is the SMILES notation for ethane;N'-hydroxyoctanediamide?
The canonical SMILES for ethane;N'-hydroxyoctanediamide is CC.NC(=O)CCCCCCC(=O)NO.
What is the InChIKey of ethane;N'-hydroxyoctanediamide?
The InChIKey is QYHHLUIMNHDJJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O3.C2H6/c9-7(11)5-3-1-2-4-6-8(12)10-13;1-2/h13H,1-6H2,(H2,9,11)(H,10,12);1-2H3.
What are the key properties of ethane;N'-hydroxyoctanediamide?
ethane;N'-hydroxyoctanediamide has a molecular weight of 218.30 g/mol, XLogP of 1.34, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-hydroxyoctanediamide is sourced from PubChem (CID 144754010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).