About ethane;N-hydroxyheptanamide;molecular hydrogen
ethane;N-hydroxyheptanamide;molecular hydrogen (PubChem CID 143457866) has the molecular formula C9H23NO2
and a molecular weight of 177.29 g/mol. Its IUPAC name is ethane;N-hydroxyheptanamide;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;N-hydroxyheptanamide;molecular hydrogen |
| PubChem CID | 143457866 |
| Molecular Formula | C9H23NO2 |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.17 |
| IUPAC Name | ethane;N-hydroxyheptanamide;molecular hydrogen |
| SMILES | CC.CCCCCCC(=O)NO.[H][H] |
| InChI | InChI=1S/C7H15NO2.C2H6.H2/c1-2-3-4-5-6-7(9)8-10;1-2;/h10H,2-6H2,1H3,(H,8,9);1-2H3;1H |
| InChIKey | YYKJNSZTQAMMBX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-hydroxyheptanamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-hydroxyheptanamide;molecular hydrogen?
The IUPAC name of ethane;N-hydroxyheptanamide;molecular hydrogen (CID 143457866) is ethane;N-hydroxyheptanamide;molecular hydrogen.
What is the SMILES notation for ethane;N-hydroxyheptanamide;molecular hydrogen?
The canonical SMILES for ethane;N-hydroxyheptanamide;molecular hydrogen is CC.CCCCCCC(=O)NO.[H][H].
What is the InChIKey of ethane;N-hydroxyheptanamide;molecular hydrogen?
The InChIKey is YYKJNSZTQAMMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C2H6.H2/c1-2-3-4-5-6-7(9)8-10;1-2;/h10H,2-6H2,1H3,(H,8,9);1-2H3;1H.
What are the key properties of ethane;N-hydroxyheptanamide;molecular hydrogen?
ethane;N-hydroxyheptanamide;molecular hydrogen has a molecular weight of 177.29 g/mol, XLogP of 2.73, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-hydroxyheptanamide;molecular hydrogen is sourced from PubChem (CID 143457866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).