About butan-1-ol;N'-hydroxybutanediamide
butan-1-ol;N'-hydroxybutanediamide (PubChem CID 174644880) has the molecular formula C8H18N2O4
and a molecular weight of 206.24 g/mol. Its IUPAC name is butan-1-ol;N'-hydroxybutanediamide.
Molecular Properties
| Compound Name | butan-1-ol;N'-hydroxybutanediamide |
| PubChem CID | 174644880 |
| Molecular Formula | C8H18N2O4 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | butan-1-ol;N'-hydroxybutanediamide |
| SMILES | CCCCO.NC(=O)CCC(=O)NO |
| InChI | InChI=1S/C4H8N2O3.C4H10O/c5-3(7)1-2-4(8)6-9;1-2-3-4-5/h9H,1-2H2,(H2,5,7)(H,6,8);5H,2-4H2,1H3 |
| InChIKey | BHPHOGNZXXAFMH-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butan-1-ol;N'-hydroxybutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;N'-hydroxybutanediamide?
The IUPAC name of butan-1-ol;N'-hydroxybutanediamide (CID 174644880) is butan-1-ol;N'-hydroxybutanediamide.
What is the SMILES notation for butan-1-ol;N'-hydroxybutanediamide?
The canonical SMILES for butan-1-ol;N'-hydroxybutanediamide is CCCCO.NC(=O)CCC(=O)NO.
What is the InChIKey of butan-1-ol;N'-hydroxybutanediamide?
The InChIKey is BHPHOGNZXXAFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O3.C4H10O/c5-3(7)1-2-4(8)6-9;1-2-3-4-5/h9H,1-2H2,(H2,5,7)(H,6,8);5H,2-4H2,1H3.
What are the key properties of butan-1-ol;N'-hydroxybutanediamide?
butan-1-ol;N'-hydroxybutanediamide has a molecular weight of 206.24 g/mol, XLogP of -0.46, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;N'-hydroxybutanediamide is sourced from PubChem (CID 174644880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).