C16H33NO3 — CID 87686064
N,16-dihydroxyhexadecanamide (PubChem CID 87686064) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is N,16-dihydroxyhexadecanamide.
| Compound Name | N,16-dihydroxyhexadecanamide |
|---|---|
| PubChem CID | 87686064 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | N,16-dihydroxyhexadecanamide |
| SMILES | O=C(CCCCCCCCCCCCCCCO)NO |
| InChI | InChI=1S/C16H33NO3/c18-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(19)17-20/h18,20H,1-15H2,(H,17,19) |
| InChIKey | CEWQYCKVTVFFKV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|