About chloroethane;N'-hydroxybutanediamide
chloroethane;N'-hydroxybutanediamide (PubChem CID 174689229) has the molecular formula C6H13ClN2O3
and a molecular weight of 196.63 g/mol. Its IUPAC name is chloroethane;N'-hydroxybutanediamide.
Molecular Properties
| Compound Name | chloroethane;N'-hydroxybutanediamide |
| PubChem CID | 174689229 |
| Molecular Formula | C6H13ClN2O3 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | chloroethane;N'-hydroxybutanediamide |
| SMILES | CCCl.NC(=O)CCC(=O)NO |
| InChI | InChI=1S/C4H8N2O3.C2H5Cl/c5-3(7)1-2-4(8)6-9;1-2-3/h9H,1-2H2,(H2,5,7)(H,6,8);2H2,1H3 |
| InChIKey | AFZHOJFXGDPNPZ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze chloroethane;N'-hydroxybutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethane;N'-hydroxybutanediamide?
The IUPAC name of chloroethane;N'-hydroxybutanediamide (CID 174689229) is chloroethane;N'-hydroxybutanediamide.
What is the SMILES notation for chloroethane;N'-hydroxybutanediamide?
The canonical SMILES for chloroethane;N'-hydroxybutanediamide is CCCl.NC(=O)CCC(=O)NO.
What is the InChIKey of chloroethane;N'-hydroxybutanediamide?
The InChIKey is AFZHOJFXGDPNPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O3.C2H5Cl/c5-3(7)1-2-4(8)6-9;1-2-3/h9H,1-2H2,(H2,5,7)(H,6,8);2H2,1H3.
What are the key properties of chloroethane;N'-hydroxybutanediamide?
chloroethane;N'-hydroxybutanediamide has a molecular weight of 196.63 g/mol, XLogP of 0.00, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethane;N'-hydroxybutanediamide is sourced from PubChem (CID 174689229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).