About ethanethioic S-acid;N'-hydroxybutanediamide
ethanethioic S-acid;N'-hydroxybutanediamide (PubChem CID 174445258) has the molecular formula C6H12N2O4S
and a molecular weight of 208.24 g/mol. Its IUPAC name is ethanethioic S-acid;N'-hydroxybutanediamide.
Molecular Properties
| Compound Name | ethanethioic S-acid;N'-hydroxybutanediamide |
| PubChem CID | 174445258 |
| Molecular Formula | C6H12N2O4S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | ethanethioic S-acid;N'-hydroxybutanediamide |
| SMILES | CC(=O)S.NC(=O)CCC(=O)NO |
| InChI | InChI=1S/C4H8N2O3.C2H4OS/c5-3(7)1-2-4(8)6-9;1-2(3)4/h9H,1-2H2,(H2,5,7)(H,6,8);1H3,(H,3,4) |
| InChIKey | JIDMNUDDLALRGT-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethanethioic S-acid;N'-hydroxybutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanethioic S-acid;N'-hydroxybutanediamide?
The IUPAC name of ethanethioic S-acid;N'-hydroxybutanediamide (CID 174445258) is ethanethioic S-acid;N'-hydroxybutanediamide.
What is the SMILES notation for ethanethioic S-acid;N'-hydroxybutanediamide?
The canonical SMILES for ethanethioic S-acid;N'-hydroxybutanediamide is CC(=O)S.NC(=O)CCC(=O)NO.
What is the InChIKey of ethanethioic S-acid;N'-hydroxybutanediamide?
The InChIKey is JIDMNUDDLALRGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O3.C2H4OS/c5-3(7)1-2-4(8)6-9;1-2(3)4/h9H,1-2H2,(H2,5,7)(H,6,8);1H3,(H,3,4).
What are the key properties of ethanethioic S-acid;N'-hydroxybutanediamide?
ethanethioic S-acid;N'-hydroxybutanediamide has a molecular weight of 208.24 g/mol, XLogP of -0.78, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanethioic S-acid;N'-hydroxybutanediamide is sourced from PubChem (CID 174445258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).