About carbamodithioic acid;N-hydroxyacetamide
carbamodithioic acid;N-hydroxyacetamide (PubChem CID 174762397) has the molecular formula C3H8N2O2S2
and a molecular weight of 168.24 g/mol. Its IUPAC name is carbamodithioic acid;N-hydroxyacetamide.
Molecular Properties
| Compound Name | carbamodithioic acid;N-hydroxyacetamide |
| PubChem CID | 174762397 |
| Molecular Formula | C3H8N2O2S2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.00 |
| IUPAC Name | carbamodithioic acid;N-hydroxyacetamide |
| SMILES | CC(=O)NO.NC(=S)S |
| InChI | InChI=1S/C2H5NO2.CH3NS2/c1-2(4)3-5;2-1(3)4/h5H,1H3,(H,3,4);(H3,2,3,4) |
| InChIKey | UBDXPWSJOALGAX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamodithioic acid;N-hydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamodithioic acid;N-hydroxyacetamide?
The IUPAC name of carbamodithioic acid;N-hydroxyacetamide (CID 174762397) is carbamodithioic acid;N-hydroxyacetamide.
What is the SMILES notation for carbamodithioic acid;N-hydroxyacetamide?
The canonical SMILES for carbamodithioic acid;N-hydroxyacetamide is CC(=O)NO.NC(=S)S.
What is the InChIKey of carbamodithioic acid;N-hydroxyacetamide?
The InChIKey is UBDXPWSJOALGAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.CH3NS2/c1-2(4)3-5;2-1(3)4/h5H,1H3,(H,3,4);(H3,2,3,4).
What are the key properties of carbamodithioic acid;N-hydroxyacetamide?
carbamodithioic acid;N-hydroxyacetamide has a molecular weight of 168.24 g/mol, XLogP of -0.33, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamodithioic acid;N-hydroxyacetamide is sourced from PubChem (CID 174762397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).