About dichloromethane;N-hydroxyacetamide
dichloromethane;N-hydroxyacetamide (PubChem CID 175349163) has the molecular formula C3H7Cl2NO2
and a molecular weight of 160.00 g/mol. Its IUPAC name is dichloromethane;N-hydroxyacetamide.
Molecular Properties
| Compound Name | dichloromethane;N-hydroxyacetamide |
| PubChem CID | 175349163 |
| Molecular Formula | C3H7Cl2NO2 |
| Molecular Weight | 160.00 g/mol |
| Exact Mass | 158.99 |
| IUPAC Name | dichloromethane;N-hydroxyacetamide |
| SMILES | CC(=O)NO.ClCCl |
| InChI | InChI=1S/C2H5NO2.CH2Cl2/c1-2(4)3-5;2-1-3/h5H,1H3,(H,3,4);1H2 |
| InChIKey | NPRMDNMGQCPQCR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.00 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;N-hydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;N-hydroxyacetamide?
The IUPAC name of dichloromethane;N-hydroxyacetamide (CID 175349163) is dichloromethane;N-hydroxyacetamide.
What is the SMILES notation for dichloromethane;N-hydroxyacetamide?
The canonical SMILES for dichloromethane;N-hydroxyacetamide is CC(=O)NO.ClCCl.
What is the InChIKey of dichloromethane;N-hydroxyacetamide?
The InChIKey is NPRMDNMGQCPQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.CH2Cl2/c1-2(4)3-5;2-1-3/h5H,1H3,(H,3,4);1H2.
What are the key properties of dichloromethane;N-hydroxyacetamide?
dichloromethane;N-hydroxyacetamide has a molecular weight of 160.00 g/mol, XLogP of 0.93, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;N-hydroxyacetamide is sourced from PubChem (CID 175349163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).