About CID 59966952
CID 59966952 (PubChem CID 59966952) has the molecular formula C3H5NO
and a molecular weight of 71.08 g/mol.
Molecular Properties
| Compound Name | CID 59966952 |
| PubChem CID | 59966952 |
| Molecular Formula | C3H5NO |
| Molecular Weight | 71.08 g/mol |
| Exact Mass | 71.04 |
| IUPAC Name | — |
| SMILES | [CH]NC(C)=O |
| InChI | InChI=1S/C3H5NO/c1-3(5)4-2/h2H,1H3,(H,4,5) |
| InChIKey | WVUKPISWADCGGD-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 71.08 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze CID 59966952 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59966952?
The IUPAC name of CID 59966952 (CID 59966952) is not available.
What is the SMILES notation for CID 59966952?
The canonical SMILES for CID 59966952 is [CH]NC(C)=O.
What is the InChIKey of CID 59966952?
The InChIKey is WVUKPISWADCGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO/c1-3(5)4-2/h2H,1H3,(H,4,5).
What are the key properties of CID 59966952?
CID 59966952 has a molecular weight of 71.08 g/mol, XLogP of -0.21, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59966952 is sourced from PubChem (CID 59966952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).