About diacetamido(dichloro)-λ5-bismuthane
diacetamido(dichloro)-λ5-bismuthane (PubChem CID 173273515) has the molecular formula C4H9BiCl2N2O2
and a molecular weight of 397.01 g/mol. Its IUPAC name is diacetamido(dichloro)-λ5-bismuthane.
Molecular Properties
| Compound Name | diacetamido(dichloro)-λ5-bismuthane |
| PubChem CID | 173273515 |
| Molecular Formula | C4H9BiCl2N2O2 |
| Molecular Weight | 397.01 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | diacetamido(dichloro)-λ5-bismuthane |
| SMILES | CC(=O)N[BiH](Cl)(Cl)NC(C)=O |
| InChI | InChI=1S/2C2H5NO.Bi.2ClH.H/c2*1-2(3)4;;;;/h2*1H3,(H2,3,4);;2*1H;/q;;+4;;;/p-4 |
| InChIKey | MCPRNTIOMKAMPM-UHFFFAOYSA-J |
| XLogP | -0.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.01 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diacetamido(dichloro)-λ5-bismuthane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diacetamido(dichloro)-λ5-bismuthane?
The IUPAC name of diacetamido(dichloro)-λ5-bismuthane (CID 173273515) is diacetamido(dichloro)-λ5-bismuthane.
What is the SMILES notation for diacetamido(dichloro)-λ5-bismuthane?
The canonical SMILES for diacetamido(dichloro)-λ5-bismuthane is CC(=O)N[BiH](Cl)(Cl)NC(C)=O.
What is the InChIKey of diacetamido(dichloro)-λ5-bismuthane?
The InChIKey is MCPRNTIOMKAMPM-UHFFFAOYSA-J. The full InChI is InChI=1S/2C2H5NO.Bi.2ClH.H/c2*1-2(3)4;;;;/h2*1H3,(H2,3,4);;2*1H;/q;;+4;;;/p-4.
What are the key properties of diacetamido(dichloro)-λ5-bismuthane?
diacetamido(dichloro)-λ5-bismuthane has a molecular weight of 397.01 g/mol, XLogP of -0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diacetamido(dichloro)-λ5-bismuthane is sourced from PubChem (CID 173273515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).