About acetohydrazide
acetohydrazide (PubChem CID 169432654) has the molecular formula C2H6N2O
and a molecular weight of 76.07 g/mol. Its IUPAC name is acetohydrazide.
Molecular Properties
| Compound Name | acetohydrazide |
| PubChem CID | 169432654 |
| Molecular Formula | C2H6N2O |
| Molecular Weight | 76.07 g/mol |
| Exact Mass | 76.04 |
| IUPAC Name | acetohydrazide |
| SMILES | CC(=O)[15NH][15NH2] |
| InChI | InChI=1S/C2H6N2O/c1-2(5)4-3/h3H2,1H3,(H,4,5)/i3+1,4+1 |
| InChIKey | OFLXLNCGODUUOT-CQDYUVAPSA-N |
| XLogP | -1.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 76.07 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetohydrazide?
The IUPAC name of acetohydrazide (CID 169432654) is acetohydrazide.
What is the SMILES notation for acetohydrazide?
The canonical SMILES for acetohydrazide is CC(=O)[15NH][15NH2].
What is the InChIKey of acetohydrazide?
The InChIKey is OFLXLNCGODUUOT-CQDYUVAPSA-N. The full InChI is InChI=1S/C2H6N2O/c1-2(5)4-3/h3H2,1H3,(H,4,5)/i3+1,4+1.
What are the key properties of acetohydrazide?
acetohydrazide has a molecular weight of 76.07 g/mol, XLogP of -1.00, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetohydrazide is sourced from PubChem (CID 169432654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).