About 1-aminopropan-2-one;aminourea
1-aminopropan-2-one;aminourea (PubChem CID 157197448) has the molecular formula C4H12N4O2
and a molecular weight of 148.17 g/mol. Its IUPAC name is 1-aminopropan-2-one;aminourea.
Molecular Properties
| Compound Name | 1-aminopropan-2-one;aminourea |
| PubChem CID | 157197448 |
| Molecular Formula | C4H12N4O2 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-aminopropan-2-one;aminourea |
| SMILES | CC(=O)CN.NNC(N)=O |
| InChI | InChI=1S/C3H7NO.CH5N3O/c1-3(5)2-4;2-1(5)4-3/h2,4H2,1H3;3H2,(H3,2,4,5) |
| InChIKey | AQKIMTGYVRYYBL-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropan-2-one;aminourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-2-one;aminourea?
The IUPAC name of 1-aminopropan-2-one;aminourea (CID 157197448) is 1-aminopropan-2-one;aminourea.
What is the SMILES notation for 1-aminopropan-2-one;aminourea?
The canonical SMILES for 1-aminopropan-2-one;aminourea is CC(=O)CN.NNC(N)=O.
What is the InChIKey of 1-aminopropan-2-one;aminourea?
The InChIKey is AQKIMTGYVRYYBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.CH5N3O/c1-3(5)2-4;2-1(5)4-3/h2,4H2,1H3;3H2,(H3,2,4,5).
What are the key properties of 1-aminopropan-2-one;aminourea?
1-aminopropan-2-one;aminourea has a molecular weight of 148.17 g/mol, XLogP of -1.94, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-one;aminourea is sourced from PubChem (CID 157197448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).