About N'-aminoacetohydrazide
N'-aminoacetohydrazide (PubChem CID 57207705) has the molecular formula C2H7N3O
and a molecular weight of 89.10 g/mol. Its IUPAC name is N'-aminoacetohydrazide.
Molecular Properties
| Compound Name | N'-aminoacetohydrazide |
| PubChem CID | 57207705 |
| Molecular Formula | C2H7N3O |
| Molecular Weight | 89.10 g/mol |
| Exact Mass | 89.06 |
| IUPAC Name | N'-aminoacetohydrazide |
| SMILES | CC(=O)NNN |
| InChI | InChI=1S/C2H7N3O/c1-2(6)4-5-3/h5H,3H2,1H3,(H,4,6) |
| InChIKey | HPVMXAKKZWDYLT-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.10 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-aminoacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-aminoacetohydrazide?
The IUPAC name of N'-aminoacetohydrazide (CID 57207705) is N'-aminoacetohydrazide.
What is the SMILES notation for N'-aminoacetohydrazide?
The canonical SMILES for N'-aminoacetohydrazide is CC(=O)NNN.
What is the InChIKey of N'-aminoacetohydrazide?
The InChIKey is HPVMXAKKZWDYLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N3O/c1-2(6)4-5-3/h5H,3H2,1H3,(H,4,6).
What are the key properties of N'-aminoacetohydrazide?
N'-aminoacetohydrazide has a molecular weight of 89.10 g/mol, XLogP of -1.50, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-aminoacetohydrazide is sourced from PubChem (CID 57207705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).