About methyl N-hydrazinylcarbamate;hydrate
methyl N-hydrazinylcarbamate;hydrate (PubChem CID 174928646) has the molecular formula C2H9N3O3
and a molecular weight of 123.11 g/mol. Its IUPAC name is methyl N-hydrazinylcarbamate;hydrate.
Molecular Properties
| Compound Name | methyl N-hydrazinylcarbamate;hydrate |
| PubChem CID | 174928646 |
| Molecular Formula | C2H9N3O3 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.06 |
| IUPAC Name | methyl N-hydrazinylcarbamate;hydrate |
| SMILES | COC(=O)NNN.O |
| InChI | InChI=1S/C2H7N3O2.H2O/c1-7-2(6)4-5-3;/h5H,3H2,1H3,(H,4,6);1H2 |
| InChIKey | LXADNLAERSNDSD-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-hydrazinylcarbamate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-hydrazinylcarbamate;hydrate?
The IUPAC name of methyl N-hydrazinylcarbamate;hydrate (CID 174928646) is methyl N-hydrazinylcarbamate;hydrate.
What is the SMILES notation for methyl N-hydrazinylcarbamate;hydrate?
The canonical SMILES for methyl N-hydrazinylcarbamate;hydrate is COC(=O)NNN.O.
What is the InChIKey of methyl N-hydrazinylcarbamate;hydrate?
The InChIKey is LXADNLAERSNDSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N3O2.H2O/c1-7-2(6)4-5-3;/h5H,3H2,1H3,(H,4,6);1H2.
What are the key properties of methyl N-hydrazinylcarbamate;hydrate?
methyl N-hydrazinylcarbamate;hydrate has a molecular weight of 123.11 g/mol, XLogP of -2.10, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-hydrazinylcarbamate;hydrate is sourced from PubChem (CID 174928646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).