About methyl N-hydrazinylcarbamate
methyl N-hydrazinylcarbamate (PubChem CID 90211551) has the molecular formula C2H7N3O2
and a molecular weight of 105.10 g/mol. Its IUPAC name is methyl N-hydrazinylcarbamate.
Molecular Properties
| Compound Name | methyl N-hydrazinylcarbamate |
| PubChem CID | 90211551 |
| Molecular Formula | C2H7N3O2 |
| Molecular Weight | 105.10 g/mol |
| Exact Mass | 105.05 |
| IUPAC Name | methyl N-hydrazinylcarbamate |
| SMILES | COC(=O)NNN |
| InChI | InChI=1S/C2H7N3O2/c1-7-2(6)4-5-3/h5H,3H2,1H3,(H,4,6) |
| InChIKey | PDSPMGBBZNHGLB-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.10 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-hydrazinylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-hydrazinylcarbamate?
The IUPAC name of methyl N-hydrazinylcarbamate (CID 90211551) is methyl N-hydrazinylcarbamate.
What is the SMILES notation for methyl N-hydrazinylcarbamate?
The canonical SMILES for methyl N-hydrazinylcarbamate is COC(=O)NNN.
What is the InChIKey of methyl N-hydrazinylcarbamate?
The InChIKey is PDSPMGBBZNHGLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N3O2/c1-7-2(6)4-5-3/h5H,3H2,1H3,(H,4,6).
What are the key properties of methyl N-hydrazinylcarbamate?
methyl N-hydrazinylcarbamate has a molecular weight of 105.10 g/mol, XLogP of -1.28, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-hydrazinylcarbamate is sourced from PubChem (CID 90211551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).