C5H9NO5 — CID 11412561
methyl 2-hydroxy-2-(methoxycarbonylamino)acetate (PubChem CID 11412561) has the molecular formula C5H9NO5 and a molecular weight of 163.13 g/mol. Its IUPAC name is methyl 2-hydroxy-2-(methoxycarbonylamino)acetate.
| Compound Name | methyl 2-hydroxy-2-(methoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 11412561 |
| Molecular Formula | C5H9NO5 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | methyl 2-hydroxy-2-(methoxycarbonylamino)acetate |
| SMILES | COC(=O)NC(O)C(=O)OC |
| InChI | InChI=1S/C5H9NO5/c1-10-4(8)3(7)6-5(9)11-2/h3,7H,1-2H3,(H,6,9) |
| InChIKey | OYEZKPKNCOVTHZ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|