C8H13NO5 — CID 122576102
methyl 2-hydroxy-2-[[(1R,2R)-2-methylcyclopropyl]oxycarbonylamino]acetate (PubChem CID 122576102) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is methyl 2-hydroxy-2-[[(1R,2R)-2-methylcyclopropyl]oxycarbonylamino]acetate.
| Compound Name | methyl 2-hydroxy-2-[[(1R,2R)-2-methylcyclopropyl]oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 122576102 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | methyl 2-hydroxy-2-[[(1R,2R)-2-methylcyclopropyl]oxycarbonylamino]acetate |
| SMILES | COC(=O)C(O)NC(=O)O[C@@H]1C[C@H]1C |
| InChI | InChI=1S/C8H13NO5/c1-4-3-5(4)14-8(12)9-6(10)7(11)13-2/h4-6,10H,3H2,1-2H3,(H,9,12)/t4-,5-,6?/m1/s1 |
| InChIKey | VHHRXQNNGWWOBB-QYRBDRAASA-N |
| XLogP | -0.39 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|