C7H12O4 — CID 131010889
methyl (2S)-2-[(2R,3R)-2,3-dimethyloxiran-2-yl]-2-hydroxyacetate (PubChem CID 131010889) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is methyl (2S)-2-[(2R,3R)-2,3-dimethyloxiran-2-yl]-2-hydroxyacetate.
| Compound Name | methyl (2S)-2-[(2R,3R)-2,3-dimethyloxiran-2-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 131010889 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | methyl (2S)-2-[(2R,3R)-2,3-dimethyloxiran-2-yl]-2-hydroxyacetate |
| SMILES | COC(=O)[C@@H](O)[C@@]1(C)O[C@@H]1C |
| InChI | InChI=1S/C7H12O4/c1-4-7(2,11-4)5(8)6(9)10-3/h4-5,8H,1-3H3/t4-,5-,7+/m1/s1 |
| InChIKey | WLEMORFSHYPTQL-XAHCXIQSSA-N |
| XLogP | -0.30 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|