C11H17NO3 — CID 79127776
methyl 2-(1-cyano-3-methylcyclohexyl)-2-hydroxyacetate (PubChem CID 79127776) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl 2-(1-cyano-3-methylcyclohexyl)-2-hydroxyacetate.
| Compound Name | methyl 2-(1-cyano-3-methylcyclohexyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 79127776 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | methyl 2-(1-cyano-3-methylcyclohexyl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)C1(C#N)CCCC(C)C1 |
| InChI | InChI=1S/C11H17NO3/c1-8-4-3-5-11(6-8,7-12)9(13)10(14)15-2/h8-9,13H,3-6H2,1-2H3 |
| InChIKey | RWXFJMGUGKZPNQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |