C14H27NO3 — CID 79123304
methyl 2-[1-(aminomethyl)-4-tert-butylcyclohexyl]-2-hydroxyacetate (PubChem CID 79123304) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is methyl 2-[1-(aminomethyl)-4-tert-butylcyclohexyl]-2-hydroxyacetate.
| Compound Name | methyl 2-[1-(aminomethyl)-4-tert-butylcyclohexyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 79123304 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | methyl 2-[1-(aminomethyl)-4-tert-butylcyclohexyl]-2-hydroxyacetate |
| SMILES | COC(=O)C(O)C1(CN)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27NO3/c1-13(2,3)10-5-7-14(9-15,8-6-10)11(16)12(17)18-4/h10-11,16H,5-9,15H2,1-4H3 |
| InChIKey | JBXFAUFJWZJELD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |