C17H35NO — CID 79138435
1-[1-(aminomethyl)-4-tert-butylcyclohexyl]-2-ethylbutan-1-ol (PubChem CID 79138435) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-4-tert-butylcyclohexyl]-2-ethylbutan-1-ol.
| Compound Name | 1-[1-(aminomethyl)-4-tert-butylcyclohexyl]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 79138435 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | 1-[1-(aminomethyl)-4-tert-butylcyclohexyl]-2-ethylbutan-1-ol |
| SMILES | CCC(CC)C(O)C1(CN)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H35NO/c1-6-13(7-2)15(19)17(12-18)10-8-14(9-11-17)16(3,4)5/h13-15,19H,6-12,18H2,1-5H3 |
| InChIKey | AEMGSFQZSHSBLL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |