C13H24O3 — CID 118380454
methyl 4-tert-butyl-1-(hydroxymethyl)cyclohexane-1-carboxylate (PubChem CID 118380454) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is methyl 4-tert-butyl-1-(hydroxymethyl)cyclohexane-1-carboxylate.
| Compound Name | methyl 4-tert-butyl-1-(hydroxymethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118380454 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | methyl 4-tert-butyl-1-(hydroxymethyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(CO)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H24O3/c1-12(2,3)10-5-7-13(9-14,8-6-10)11(15)16-4/h10,14H,5-9H2,1-4H3 |
| InChIKey | PZHBMPAJDRJYQD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |